About 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine
1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine (PubChem CID 177020946) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine.
Molecular Properties
| Compound Name | 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine |
| PubChem CID | 177020946 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine |
| SMILES | C=C/C=C(\C=C)CCCN1CCN(CCOCC)CC1 |
| InChI | InChI=1S/C17H30N2O/c1-4-8-17(5-2)9-7-10-18-11-13-19(14-12-18)15-16-20-6-3/h4-5,8H,1-2,6-7,9-16H2,3H3/b17-8+ |
| InChIKey | VWCBRIVDUZXHQZ-CAOOACKPSA-N |
| XLogP | 2.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine?
The IUPAC name of 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine (CID 177020946) is 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine.
What is the SMILES notation for 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine?
The canonical SMILES for 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine is C=C/C=C(\C=C)CCCN1CCN(CCOCC)CC1.
What is the InChIKey of 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine?
The InChIKey is VWCBRIVDUZXHQZ-CAOOACKPSA-N. The full InChI is InChI=1S/C17H30N2O/c1-4-8-17(5-2)9-7-10-18-11-13-19(14-12-18)15-16-20-6-3/h4-5,8H,1-2,6-7,9-16H2,3H3/b17-8+.
What are the key properties of 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine?
1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine has a molecular weight of 278.44 g/mol, XLogP of 2.72, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z)-4-ethenylhepta-4,6-dienyl]-4-(2-ethoxyethyl)piperazine is sourced from PubChem (CID 177020946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).