C19H42N4O5 — CID 177055074
4-[4-(2-ethoxyethyl)piperazin-1-yl]-N-methylbutanamide;[2-(2-methoxyethoxy)ethylamino]methanol (PubChem CID 177055074) has the molecular formula C19H42N4O5 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[4-(2-ethoxyethyl)piperazin-1-yl]-N-methylbutanamide;[2-(2-methoxyethoxy)ethylamino]methanol.
| Compound Name | 4-[4-(2-ethoxyethyl)piperazin-1-yl]-N-methylbutanamide;[2-(2-methoxyethoxy)ethylamino]methanol |
|---|---|
| PubChem CID | 177055074 |
| Molecular Formula | C19H42N4O5 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 4-[4-(2-ethoxyethyl)piperazin-1-yl]-N-methylbutanamide;[2-(2-methoxyethoxy)ethylamino]methanol |
| SMILES | CCOCCN1CCN(CCCC(=O)NC)CC1.COCCOCCNCO |
| InChI | InChI=1S/C13H27N3O2.C6H15NO3/c1-3-18-12-11-16-9-7-15(8-10-16)6-4-5-13(17)14-2;1-9-4-5-10-3-2-7-6-8/h3-12H2,1-2H3,(H,14,17);7-8H,2-6H2,1H3 |
| InChIKey | ABMJTZFPDMSEOJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|