C12H18ClN — CID 123897447
1-(7-chloro-4-ethenylhepta-4,6-dienyl)azetidine (PubChem CID 123897447) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 1-(7-chloro-4-ethenylhepta-4,6-dienyl)azetidine.
| Compound Name | 1-(7-chloro-4-ethenylhepta-4,6-dienyl)azetidine |
|---|---|
| PubChem CID | 123897447 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(7-chloro-4-ethenylhepta-4,6-dienyl)azetidine |
| SMILES | C=CC(=CC=CCl)CCCN1CCC1 |
| InChI | InChI=1S/C12H18ClN/c1-2-12(6-3-8-13)7-4-9-14-10-5-11-14/h2-3,6,8H,1,4-5,7,9-11H2 |
| InChIKey | OVKZYLXILZELEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|