C24H41N3O — CID 167203975
(2S)-2-amino-4-cyclopropyl-N-[(2R,3E,5Z)-6-ethenyl-3-methyl-10-pyrrolidin-1-yldeca-3,5-dien-2-yl]butanamide (PubChem CID 167203975) has the molecular formula C24H41N3O and a molecular weight of 387.61 g/mol. Its IUPAC name is (2S)-2-amino-4-cyclopropyl-N-[(2R,3E,5Z)-6-ethenyl-3-methyl-10-pyrrolidin-1-yldeca-3,5-dien-2-yl]butanamide.
| Compound Name | (2S)-2-amino-4-cyclopropyl-N-[(2R,3E,5Z)-6-ethenyl-3-methyl-10-pyrrolidin-1-yldeca-3,5-dien-2-yl]butanamide |
|---|---|
| PubChem CID | 167203975 |
| Molecular Formula | C24H41N3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | (2S)-2-amino-4-cyclopropyl-N-[(2R,3E,5Z)-6-ethenyl-3-methyl-10-pyrrolidin-1-yldeca-3,5-dien-2-yl]butanamide |
| SMILES | C=C/C(=C\C=C(/C)[C@@H](C)NC(=O)[C@@H](N)CCC1CC1)CCCCN1CCCC1 |
| InChI | InChI=1S/C24H41N3O/c1-4-21(9-5-6-16-27-17-7-8-18-27)11-10-19(2)20(3)26-24(28)23(25)15-14-22-12-13-22/h4,10-11,20,22-23H,1,5-9,12-18,25H2,2-3H3,(H,26,28)/b19-10+,21-11+/t20-,23+/m1/s1 |
| InChIKey | GIIWRYPGIJBDOK-QXOIJUHISA-N |
| XLogP | 4.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|