C22H43N5O — CID 109482772
1-[4-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide (PubChem CID 109482772) has the molecular formula C22H43N5O and a molecular weight of 393.62 g/mol. Its IUPAC name is 1-[4-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 109482772 |
| Molecular Formula | C22H43N5O |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.35 |
| IUPAC Name | 1-[4-[[N-(4-cyclohexylbutan-2-yl)-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide |
| SMILES | C/N=C(/NCCCCN1CCC(C(N)=O)CC1)NC(C)CCC1CCCCC1 |
| InChI | InChI=1S/C22H43N5O/c1-18(10-11-19-8-4-3-5-9-19)26-22(24-2)25-14-6-7-15-27-16-12-20(13-17-27)21(23)28/h18-20H,3-17H2,1-2H3,(H2,23,28)(H2,24,25,26) |
| InChIKey | MDGOWBWUGMXNMZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|