About 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine
3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 158606290) has the molecular formula C16H33ClN2O
and a molecular weight of 304.91 g/mol. Its IUPAC name is 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine |
| PubChem CID | 158606290 |
| Molecular Formula | C16H33ClN2O |
| Molecular Weight | 304.91 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | C.NCCCN1CCCC1.O=C(Cl)CCC1CCCC1 |
| InChI | InChI=1S/C8H13ClO.C7H16N2.CH4/c9-8(10)6-5-7-3-1-2-4-7;8-4-3-7-9-5-1-2-6-9;/h7H,1-6H2;1-8H2;1H4 |
| InChIKey | HWGRGCYIVFUVRC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine?
The IUPAC name of 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine (CID 158606290) is 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine.
What is the SMILES notation for 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine?
The canonical SMILES for 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine is C.NCCCN1CCCC1.O=C(Cl)CCC1CCCC1.
What is the InChIKey of 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine?
The InChIKey is HWGRGCYIVFUVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO.C7H16N2.CH4/c9-8(10)6-5-7-3-1-2-4-7;8-4-3-7-9-5-1-2-6-9;/h7H,1-6H2;1-8H2;1H4.
What are the key properties of 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine?
3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine has a molecular weight of 304.91 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropanoyl chloride;methane;3-pyrrolidin-1-ylpropan-1-amine is sourced from PubChem (CID 158606290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).