About 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine
3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine (PubChem CID 160696062) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine.
Molecular Properties
| Compound Name | 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine |
| PubChem CID | 160696062 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine |
| SMILES | NCc1ccncc1.O=C(Cl)CCC1CCCC1 |
| InChI | InChI=1S/C8H13ClO.C6H8N2/c9-8(10)6-5-7-3-1-2-4-7;7-5-6-1-3-8-4-2-6/h7H,1-6H2;1-4H,5,7H2 |
| InChIKey | RPZZJPJOGVQACQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine?
The IUPAC name of 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine (CID 160696062) is 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine.
What is the SMILES notation for 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine?
The canonical SMILES for 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine is NCc1ccncc1.O=C(Cl)CCC1CCCC1.
What is the InChIKey of 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine?
The InChIKey is RPZZJPJOGVQACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO.C6H8N2/c9-8(10)6-5-7-3-1-2-4-7;7-5-6-1-3-8-4-2-6/h7H,1-6H2;1-4H,5,7H2.
What are the key properties of 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine?
3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine has a molecular weight of 268.79 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropanoyl chloride;pyridin-4-ylmethanamine is sourced from PubChem (CID 160696062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).