About 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride
3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride (PubChem CID 161009899) has the molecular formula C19H25Cl3O4
and a molecular weight of 423.76 g/mol. Its IUPAC name is 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride.
Molecular Properties
| Compound Name | 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride |
| PubChem CID | 161009899 |
| Molecular Formula | C19H25Cl3O4 |
| Molecular Weight | 423.76 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride |
| SMILES | CCOC(=O)Cl.O=C(Cl)CCC1CCCC1.O=C(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C8H13ClO.C8H7ClO.C3H5ClO2/c9-8(10)6-5-7-3-1-2-4-7;9-8(10)6-7-4-2-1-3-5-7;1-2-6-3(4)5/h7H,1-6H2;1-5H,6H2;2H2,1H3 |
| InChIKey | TWZMYDIFVAHHEL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride?
The IUPAC name of 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride (CID 161009899) is 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride.
What is the SMILES notation for 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride?
The canonical SMILES for 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride is CCOC(=O)Cl.O=C(Cl)CCC1CCCC1.O=C(Cl)Cc1ccccc1.
What is the InChIKey of 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride?
The InChIKey is TWZMYDIFVAHHEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO.C8H7ClO.C3H5ClO2/c9-8(10)6-5-7-3-1-2-4-7;9-8(10)6-7-4-2-1-3-5-7;1-2-6-3(4)5/h7H,1-6H2;1-5H,6H2;2H2,1H3.
What are the key properties of 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride?
3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride has a molecular weight of 423.76 g/mol, XLogP of 6.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropanoyl chloride;ethyl carbonochloridate;2-phenylacetyl chloride is sourced from PubChem (CID 161009899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).