C16H28ClNO — CID 123511039
1-[2-(2-chloro-4-ethylhexa-2,4-dien-3-yl)oxyethyl]azepane (PubChem CID 123511039) has the molecular formula C16H28ClNO and a molecular weight of 285.86 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-ethylhexa-2,4-dien-3-yl)oxyethyl]azepane.
| Compound Name | 1-[2-(2-chloro-4-ethylhexa-2,4-dien-3-yl)oxyethyl]azepane |
|---|---|
| PubChem CID | 123511039 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-[2-(2-chloro-4-ethylhexa-2,4-dien-3-yl)oxyethyl]azepane |
| SMILES | CC=C(CC)C(OCCN1CCCCCC1)=C(C)Cl |
| InChI | InChI=1S/C16H28ClNO/c1-4-15(5-2)16(14(3)17)19-13-12-18-10-8-6-7-9-11-18/h4H,5-13H2,1-3H3 |
| InChIKey | VQFUEMIGTOYHKK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|