C18H32N2O3 — CID 142036467
(2E,4E)-2-ethyl-5-[2-[methyl(2-piperidin-1-ylethyl)amino]ethoxy]hexa-2,4-dienoic acid (PubChem CID 142036467) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2E,4E)-2-ethyl-5-[2-[methyl(2-piperidin-1-ylethyl)amino]ethoxy]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-ethyl-5-[2-[methyl(2-piperidin-1-ylethyl)amino]ethoxy]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 142036467 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | (2E,4E)-2-ethyl-5-[2-[methyl(2-piperidin-1-ylethyl)amino]ethoxy]hexa-2,4-dienoic acid |
| SMILES | CC/C(=C\C=C(/C)OCCN(C)CCN1CCCCC1)C(=O)O |
| InChI | InChI=1S/C18H32N2O3/c1-4-17(18(21)22)9-8-16(2)23-15-14-19(3)12-13-20-10-6-5-7-11-20/h8-9H,4-7,10-15H2,1-3H3,(H,21,22)/b16-8+,17-9+ |
| InChIKey | OIDYAZQWGRSPLD-GONBZBRSSA-N |
| XLogP | 2.75 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|