C11H19NO3 — CID 149063981
2-piperidin-1-ylethyl (Z)-3-methoxyprop-2-enoate (PubChem CID 149063981) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl (Z)-3-methoxyprop-2-enoate.
| Compound Name | 2-piperidin-1-ylethyl (Z)-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 149063981 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-piperidin-1-ylethyl (Z)-3-methoxyprop-2-enoate |
| SMILES | CO/C=C\C(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C11H19NO3/c1-14-9-5-11(13)15-10-8-12-6-3-2-4-7-12/h5,9H,2-4,6-8,10H2,1H3/b9-5- |
| InChIKey | QMJVDUABRVUJHP-UITAMQMPSA-N |
| XLogP | 1.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|