C10H18O — CID 89443123
2-methylbuta-1,3-diene;3-methylbut-3-en-1-ol (PubChem CID 89443123) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;3-methylbut-3-en-1-ol.
| Compound Name | 2-methylbuta-1,3-diene;3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 89443123 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2-methylbuta-1,3-diene;3-methylbut-3-en-1-ol |
| SMILES | C=C(C)CCO.C=CC(=C)C |
| InChI | InChI=1S/C5H10O.C5H8/c1-5(2)3-4-6;1-4-5(2)3/h6H,1,3-4H2,2H3;4H,1-2H2,3H3 |
| InChIKey | LMXJKRLFBUDZHV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|