About ethene;9-hydroxynonan-2-one
ethene;9-hydroxynonan-2-one (PubChem CID 23344517) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is ethene;9-hydroxynonan-2-one.
Molecular Properties
| Compound Name | ethene;9-hydroxynonan-2-one |
| PubChem CID | 23344517 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | ethene;9-hydroxynonan-2-one |
| SMILES | C=C.CC(=O)CCCCCCCO |
| InChI | InChI=1S/C9H18O2.C2H4/c1-9(11)7-5-3-2-4-6-8-10;1-2/h10H,2-8H2,1H3;1-2H2 |
| InChIKey | JQUJOPCYTRXAEZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;9-hydroxynonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;9-hydroxynonan-2-one?
The IUPAC name of ethene;9-hydroxynonan-2-one (CID 23344517) is ethene;9-hydroxynonan-2-one.
What is the SMILES notation for ethene;9-hydroxynonan-2-one?
The canonical SMILES for ethene;9-hydroxynonan-2-one is C=C.CC(=O)CCCCCCCO.
What is the InChIKey of ethene;9-hydroxynonan-2-one?
The InChIKey is JQUJOPCYTRXAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C2H4/c1-9(11)7-5-3-2-4-6-8-10;1-2/h10H,2-8H2,1H3;1-2H2.
What are the key properties of ethene;9-hydroxynonan-2-one?
ethene;9-hydroxynonan-2-one has a molecular weight of 186.29 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;9-hydroxynonan-2-one is sourced from PubChem (CID 23344517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).