C9H15NO — CID 145285923
(2E,4Z)-4-(2-aminoethyl)hepta-2,4,6-trien-2-ol (PubChem CID 145285923) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2E,4Z)-4-(2-aminoethyl)hepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4Z)-4-(2-aminoethyl)hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 145285923 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2E,4Z)-4-(2-aminoethyl)hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C=C(\C=C(/C)O)CCN |
| InChI | InChI=1S/C9H15NO/c1-3-4-9(5-6-10)7-8(2)11/h3-4,7,11H,1,5-6,10H2,2H3/b8-7+,9-4- |
| InChIKey | GZJBNXSTWYIJEJ-KCKXTUGSSA-N |
| XLogP | 1.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|