C9H14ClN — CID 166968437
(3Z,4E)-4-chloro-3-ethylidenehepta-4,6-dien-1-amine (PubChem CID 166968437) has the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. Its IUPAC name is (3Z,4E)-4-chloro-3-ethylidenehepta-4,6-dien-1-amine.
| Compound Name | (3Z,4E)-4-chloro-3-ethylidenehepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 166968437 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (3Z,4E)-4-chloro-3-ethylidenehepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(Cl)\C(=C/C)CCN |
| InChI | InChI=1S/C9H14ClN/c1-3-5-9(10)8(4-2)6-7-11/h3-5H,1,6-7,11H2,2H3/b8-4-,9-5+ |
| InChIKey | YJOHQSMUVSSUKC-MVTUOISNSA-N |
| XLogP | 2.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|