C8H13N — CID 143431961
(3Z)-3-ethylhexa-1,3,5-trien-2-amine (PubChem CID 143431961) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (3Z)-3-ethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-3-ethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143431961 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (3Z)-3-ethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C(/CC)C(=C)N |
| InChI | InChI=1S/C8H13N/c1-4-6-8(5-2)7(3)9/h4,6H,1,3,5,9H2,2H3/b8-6- |
| InChIKey | ZXWIBQTWLTVBDG-VURMDHGXSA-N |
| XLogP | 1.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|