About (3E)-5-ethylocta-1,3,7-trien-4-amine
(3E)-5-ethylocta-1,3,7-trien-4-amine (PubChem CID 134331827) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is (3E)-5-ethylocta-1,3,7-trien-4-amine.
Molecular Properties
| Compound Name | (3E)-5-ethylocta-1,3,7-trien-4-amine |
| PubChem CID | 134331827 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3E)-5-ethylocta-1,3,7-trien-4-amine |
| SMILES | C=C/C=C(/N)C(CC)CC=C |
| InChI | InChI=1S/C10H17N/c1-4-7-9(6-3)10(11)8-5-2/h4-5,8-9H,1-2,6-7,11H2,3H3/b10-8+ |
| InChIKey | VOKJCYAZYJCERE-CSKARUKUSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-ethylocta-1,3,7-trien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-ethylocta-1,3,7-trien-4-amine?
The IUPAC name of (3E)-5-ethylocta-1,3,7-trien-4-amine (CID 134331827) is (3E)-5-ethylocta-1,3,7-trien-4-amine.
What is the SMILES notation for (3E)-5-ethylocta-1,3,7-trien-4-amine?
The canonical SMILES for (3E)-5-ethylocta-1,3,7-trien-4-amine is C=C/C=C(/N)C(CC)CC=C.
What is the InChIKey of (3E)-5-ethylocta-1,3,7-trien-4-amine?
The InChIKey is VOKJCYAZYJCERE-CSKARUKUSA-N. The full InChI is InChI=1S/C10H17N/c1-4-7-9(6-3)10(11)8-5-2/h4-5,8-9H,1-2,6-7,11H2,3H3/b10-8+.
What are the key properties of (3E)-5-ethylocta-1,3,7-trien-4-amine?
(3E)-5-ethylocta-1,3,7-trien-4-amine has a molecular weight of 151.25 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-ethylocta-1,3,7-trien-4-amine is sourced from PubChem (CID 134331827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).