C14H26 — CID 173391787
4-ethyl-5-propylnona-1,5-diene (PubChem CID 173391787) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 4-ethyl-5-propylnona-1,5-diene.
| Compound Name | 4-ethyl-5-propylnona-1,5-diene |
|---|---|
| PubChem CID | 173391787 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 4-ethyl-5-propylnona-1,5-diene |
| SMILES | C=CCC(CC)C(=CCCC)CCC |
| InChI | InChI=1S/C14H26/c1-5-9-12-14(11-7-3)13(8-4)10-6-2/h6,12-13H,2,5,7-11H2,1,3-4H3 |
| InChIKey | GEYUVUGDLPUYNV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|