C15H30OSi — CID 177406065
(4S,5Z)-5-(trimethylsilylmethyl)undeca-1,5-dien-4-ol (PubChem CID 177406065) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is (4S,5Z)-5-(trimethylsilylmethyl)undeca-1,5-dien-4-ol.
| Compound Name | (4S,5Z)-5-(trimethylsilylmethyl)undeca-1,5-dien-4-ol |
|---|---|
| PubChem CID | 177406065 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (4S,5Z)-5-(trimethylsilylmethyl)undeca-1,5-dien-4-ol |
| SMILES | C=CC[C@H](O)/C(=C/CCCCC)C[Si](C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-6-8-9-10-12-14(13-17(3,4)5)15(16)11-7-2/h7,12,15-16H,2,6,8-11,13H2,1,3-5H3/b14-12+/t15-/m0/s1 |
| InChIKey | XOPGINQFCKRONR-ZQHYZAEZSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|