C15H27N — CID 139492686
(5Z,6Z)-6-ethyl-5-ethylidene-N,N-dimethylnona-6,8-dien-1-amine (PubChem CID 139492686) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (5Z,6Z)-6-ethyl-5-ethylidene-N,N-dimethylnona-6,8-dien-1-amine.
| Compound Name | (5Z,6Z)-6-ethyl-5-ethylidene-N,N-dimethylnona-6,8-dien-1-amine |
|---|---|
| PubChem CID | 139492686 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (5Z,6Z)-6-ethyl-5-ethylidene-N,N-dimethylnona-6,8-dien-1-amine |
| SMILES | C=C/C=C(CC)\C(=C/C)CCCCN(C)C |
| InChI | InChI=1S/C15H27N/c1-6-11-14(7-2)15(8-3)12-9-10-13-16(4)5/h6,8,11H,1,7,9-10,12-13H2,2-5H3/b14-11-,15-8- |
| InChIKey | RSHMPSLPBKSZGI-RTIOHFMTSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|