C21H44N2 — CID 160750261
1-N,1-N,14-N,14-N-tetramethylheptadec-16-ene-1,14-diamine (PubChem CID 160750261) has the molecular formula C21H44N2 and a molecular weight of 324.60 g/mol. Its IUPAC name is 1-N,1-N,14-N,14-N-tetramethylheptadec-16-ene-1,14-diamine.
| Compound Name | 1-N,1-N,14-N,14-N-tetramethylheptadec-16-ene-1,14-diamine |
|---|---|
| PubChem CID | 160750261 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | 1-N,1-N,14-N,14-N-tetramethylheptadec-16-ene-1,14-diamine |
| SMILES | C=CCC(CCCCCCCCCCCCCN(C)C)N(C)C |
| InChI | InChI=1S/C21H44N2/c1-6-18-21(23(4)5)19-16-14-12-10-8-7-9-11-13-15-17-20-22(2)3/h6,21H,1,7-20H2,2-5H3 |
| InChIKey | ZQJUFHMGNBILTJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|