C26H53NO — CID 166644636
N,N-dimethyloctadecan-1-amine;3-prop-2-enoxyprop-1-ene (PubChem CID 166644636) has the molecular formula C26H53NO and a molecular weight of 395.72 g/mol. Its IUPAC name is N,N-dimethyloctadecan-1-amine;3-prop-2-enoxyprop-1-ene.
| Compound Name | N,N-dimethyloctadecan-1-amine;3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 166644636 |
| Molecular Formula | C26H53NO |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 395.41 |
| IUPAC Name | N,N-dimethyloctadecan-1-amine;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.CCCCCCCCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C20H43N.C6H10O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-3-5-7-6-4-2/h4-20H2,1-3H3;3-4H,1-2,5-6H2 |
| InChIKey | VVIRPZRXDHHHOZ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|