C8H16BrN — CID 88601694
1-bromo-N,N-dimethylhex-5-en-3-amine (PubChem CID 88601694) has the molecular formula C8H16BrN and a molecular weight of 206.13 g/mol. Its IUPAC name is 1-bromo-N,N-dimethylhex-5-en-3-amine.
| Compound Name | 1-bromo-N,N-dimethylhex-5-en-3-amine |
|---|---|
| PubChem CID | 88601694 |
| Molecular Formula | C8H16BrN |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-bromo-N,N-dimethylhex-5-en-3-amine |
| SMILES | C=CCC(CCBr)N(C)C |
| InChI | InChI=1S/C8H16BrN/c1-4-5-8(6-7-9)10(2)3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | MBXREXQCXDGJLS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|