About 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine
1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine (PubChem CID 87864817) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine.
Analyze 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine?
The IUPAC name of 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine (CID 87864817) is 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine.
What is the SMILES notation for 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine?
The canonical SMILES for 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine is CNCCC(CCCN(C)C)N(C)C.
What is the InChIKey of 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine?
The InChIKey is WAMWUEVRNBZZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3/c1-12-9-8-11(14(4)5)7-6-10-13(2)3/h11-12H,6-10H2,1-5H3.
What are the key properties of 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine?
1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine has a molecular weight of 201.36 g/mol, XLogP of 0.87, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N,3-N,6-N,6-N-pentamethylhexane-1,3,6-triamine is sourced from PubChem (CID 87864817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).