C16H42N2 — CID 142969237
1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane (PubChem CID 142969237) has the molecular formula C16H42N2 and a molecular weight of 262.53 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane.
| Compound Name | 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane |
|---|---|
| PubChem CID | 142969237 |
| Molecular Formula | C16H42N2 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 262.33 |
| IUPAC Name | 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane |
| SMILES | CC.CC.CC.CCCN(C)C(CC)CCNC |
| InChI | InChI=1S/C10H24N2.3C2H6/c1-5-9-12(4)10(6-2)7-8-11-3;3*1-2/h10-11H,5-9H2,1-4H3;3*1-2H3 |
| InChIKey | GWDJBJLQBKOSBG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |