About 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane
1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane (PubChem CID 142969237) has the molecular formula C16H42N2
and a molecular weight of 262.53 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane.
Molecular Properties
| Compound Name | 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane |
| PubChem CID | 142969237 |
| Molecular Formula | C16H42N2 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 262.33 |
| IUPAC Name | 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane |
| SMILES | CC.CC.CC.CCCN(C)C(CC)CCNC |
| InChI | InChI=1S/C10H24N2.3C2H6/c1-5-9-12(4)10(6-2)7-8-11-3;3*1-2/h10-11H,5-9H2,1-4H3;3*1-2H3 |
| InChIKey | GWDJBJLQBKOSBG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane?
The IUPAC name of 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane (CID 142969237) is 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane.
What is the SMILES notation for 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane?
The canonical SMILES for 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane is CC.CC.CC.CCCN(C)C(CC)CCNC.
What is the InChIKey of 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane?
The InChIKey is GWDJBJLQBKOSBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2.3C2H6/c1-5-9-12(4)10(6-2)7-8-11-3;3*1-2/h10-11H,5-9H2,1-4H3;3*1-2H3.
What are the key properties of 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane?
1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane has a molecular weight of 262.53 g/mol, XLogP of 4.79, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-dimethyl-3-N-propylpentane-1,3-diamine;ethane is sourced from PubChem (CID 142969237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).