C21H46N2 — CID 91061045
1-N,1-N,13-N,13-N-tetramethylheptadecane-1,13-diamine (PubChem CID 91061045) has the molecular formula C21H46N2 and a molecular weight of 326.61 g/mol. Its IUPAC name is 1-N,1-N,13-N,13-N-tetramethylheptadecane-1,13-diamine.
| Compound Name | 1-N,1-N,13-N,13-N-tetramethylheptadecane-1,13-diamine |
|---|---|
| PubChem CID | 91061045 |
| Molecular Formula | C21H46N2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | 1-N,1-N,13-N,13-N-tetramethylheptadecane-1,13-diamine |
| SMILES | CCCCC(CCCCCCCCCCCCN(C)C)N(C)C |
| InChI | InChI=1S/C21H46N2/c1-6-7-18-21(23(4)5)19-16-14-12-10-8-9-11-13-15-17-20-22(2)3/h21H,6-20H2,1-5H3 |
| InChIKey | MGUPAFPFLOGFSQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|