C11H25NO2 — CID 170732723
acetaldehyde;N,N-dimethylhexan-1-amine;formaldehyde (PubChem CID 170732723) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is acetaldehyde;N,N-dimethylhexan-1-amine;formaldehyde.
| Compound Name | acetaldehyde;N,N-dimethylhexan-1-amine;formaldehyde |
|---|---|
| PubChem CID | 170732723 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | acetaldehyde;N,N-dimethylhexan-1-amine;formaldehyde |
| SMILES | C=O.CC=O.CCCCCCN(C)C |
| InChI | InChI=1S/C8H19N.C2H4O.CH2O/c1-4-5-6-7-8-9(2)3;1-2-3;1-2/h4-8H2,1-3H3;2H,1H3;1H2 |
| InChIKey | APTGFRFWEVXDMB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|