C9H13N — CID 142262554
acetylene;(2E)-2-ethenylpenta-2,4-dien-1-amine (PubChem CID 142262554) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is acetylene;(2E)-2-ethenylpenta-2,4-dien-1-amine.
| Compound Name | acetylene;(2E)-2-ethenylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142262554 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | acetylene;(2E)-2-ethenylpenta-2,4-dien-1-amine |
| SMILES | C#C.C=C/C=C(\C=C)CN |
| InChI | InChI=1S/C7H11N.C2H2/c1-3-5-7(4-2)6-8;1-2/h3-5H,1-2,6,8H2;1-2H/b7-5+; |
| InChIKey | OJSBWXBZWMUFAD-GZOLSCHFSA-N |
| XLogP | 1.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|