C8H14N2 — CID 155051577
(2E,4E)-2-ethenylhexa-2,4-diene-1,5-diamine (PubChem CID 155051577) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2E,4E)-2-ethenylhexa-2,4-diene-1,5-diamine.
| Compound Name | (2E,4E)-2-ethenylhexa-2,4-diene-1,5-diamine |
|---|---|
| PubChem CID | 155051577 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2E,4E)-2-ethenylhexa-2,4-diene-1,5-diamine |
| SMILES | C=C/C(=C\C=C(/C)N)CN |
| InChI | InChI=1S/C8H14N2/c1-3-8(6-9)5-4-7(2)10/h3-5H,1,6,9-10H2,2H3/b7-4+,8-5+ |
| InChIKey | JAZIFCJFXKYVDQ-NSLJXJERSA-N |
| XLogP | 0.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|