C9H13Cl — CID 143318485
(3Z,5Z)-2-chloro-4,5-dimethylhepta-1,3,5-triene (PubChem CID 143318485) has the molecular formula C9H13Cl and a molecular weight of 156.66 g/mol. Its IUPAC name is (3Z,5Z)-2-chloro-4,5-dimethylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-2-chloro-4,5-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143318485 |
| Molecular Formula | C9H13Cl |
| Molecular Weight | 156.66 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (3Z,5Z)-2-chloro-4,5-dimethylhepta-1,3,5-triene |
| SMILES | C=C(Cl)/C=C(C)\C(C)=C/C |
| InChI | InChI=1S/C9H13Cl/c1-5-7(2)8(3)6-9(4)10/h5-6H,4H2,1-3H3/b7-5-,8-6- |
| InChIKey | MXDATPBABCBLBO-SFECMWDFSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|