C8H11Cl — CID 123971323
2-chloro-5-methylhepta-1,3,5-triene (PubChem CID 123971323) has the molecular formula C8H11Cl and a molecular weight of 142.63 g/mol. Its IUPAC name is 2-chloro-5-methylhepta-1,3,5-triene.
| Compound Name | 2-chloro-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123971323 |
| Molecular Formula | C8H11Cl |
| Molecular Weight | 142.63 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 2-chloro-5-methylhepta-1,3,5-triene |
| SMILES | C=C(Cl)C=CC(C)=CC |
| InChI | InChI=1S/C8H11Cl/c1-4-7(2)5-6-8(3)9/h4-6H,3H2,1-2H3 |
| InChIKey | WJWBYYYWNLBWEE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|