C7H11ClN+ — CID 163699739
6-chlorohepta-2,4,6-trien-3-ylazanium (PubChem CID 163699739) has the molecular formula C7H11ClN+ and a molecular weight of 144.62 g/mol. Its IUPAC name is 6-chlorohepta-2,4,6-trien-3-ylazanium.
| Compound Name | 6-chlorohepta-2,4,6-trien-3-ylazanium |
|---|---|
| PubChem CID | 163699739 |
| Molecular Formula | C7H11ClN+ |
| Molecular Weight | 144.62 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 6-chlorohepta-2,4,6-trien-3-ylazanium |
| SMILES | C=C(Cl)C=CC([NH3+])=CC |
| InChI | InChI=1S/C7H10ClN/c1-3-7(9)5-4-6(2)8/h3-5H,2,9H2,1H3/p+1 |
| InChIKey | JZYOTCVGQMIVHA-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.62 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|