C7H10Cl- — CID 91414508
2-chloro-5-methylhexa-1,3-diene (PubChem CID 91414508) has the molecular formula C7H10Cl- and a molecular weight of 129.61 g/mol. Its IUPAC name is 2-chloro-5-methylhexa-1,3-diene.
| Compound Name | 2-chloro-5-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 91414508 |
| Molecular Formula | C7H10Cl- |
| Molecular Weight | 129.61 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 2-chloro-5-methylhexa-1,3-diene |
| SMILES | C=C(Cl)C=C[C-](C)C |
| InChI | InChI=1S/C7H10Cl/c1-6(2)4-5-7(3)8/h4-5H,3H2,1-2H3/q-1 |
| InChIKey | DYUUYGMFFVPAKI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|