C6H8ClN — CID 123742417
N-(3-chlorobuta-1,3-dienyl)ethanimine (PubChem CID 123742417) has the molecular formula C6H8ClN and a molecular weight of 129.59 g/mol. Its IUPAC name is N-(3-chlorobuta-1,3-dienyl)ethanimine.
| Compound Name | N-(3-chlorobuta-1,3-dienyl)ethanimine |
|---|---|
| PubChem CID | 123742417 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | N-(3-chlorobuta-1,3-dienyl)ethanimine |
| SMILES | C=C(Cl)C=C/N=C/C |
| InChI | InChI=1S/C6H8ClN/c1-3-8-5-4-6(2)7/h3-5H,2H2,1H3/b5-4?,8-3+ |
| InChIKey | ICKOZNHHEYLLJN-VISAMJRTSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|