C6H9NO — CID 143328048
(3Z)-4-(ethylideneamino)buta-1,3-dien-2-ol (PubChem CID 143328048) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is (3Z)-4-(ethylideneamino)buta-1,3-dien-2-ol.
| Compound Name | (3Z)-4-(ethylideneamino)buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 143328048 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | (3Z)-4-(ethylideneamino)buta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\N=C\C |
| InChI | InChI=1S/C6H9NO/c1-3-7-5-4-6(2)8/h3-5,8H,2H2,1H3/b5-4-,7-3+ |
| InChIKey | RJDVPUUZJKHDIQ-SBYNAHCQSA-N |
| XLogP | 1.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|