C12H25N — CID 142064369
ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]ethanimine (PubChem CID 142064369) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]ethanimine.
| Compound Name | ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 142064369 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | ethane;N-[(1Z,3Z)-3-methylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=C(C)\C=C/N=C/C.CC.CC |
| InChI | InChI=1S/C8H13N.2C2H6/c1-4-8(3)6-7-9-5-2;2*1-2/h4-7H,1-3H3;2*1-2H3/b7-6-,8-4-,9-5+;; |
| InChIKey | YINSYUKBMGSLKE-OYRIQZQNSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|