C9H15N — CID 90869246
N-[(1Z)-3-methylpenta-1,3-dienyl]propan-1-imine (PubChem CID 90869246) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-[(1Z)-3-methylpenta-1,3-dienyl]propan-1-imine.
| Compound Name | N-[(1Z)-3-methylpenta-1,3-dienyl]propan-1-imine |
|---|---|
| PubChem CID | 90869246 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-[(1Z)-3-methylpenta-1,3-dienyl]propan-1-imine |
| SMILES | CC=C(C)/C=C\N=C\CC |
| InChI | InChI=1S/C9H15N/c1-4-7-10-8-6-9(3)5-2/h5-8H,4H2,1-3H3/b8-6-,9-5?,10-7+ |
| InChIKey | HEMOYZHTZYTLGC-OSBOCYGOSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|