C11H19N — CID 145087914
N-[(1E,3E)-2,3-dimethylhexa-1,3-dienyl]propan-1-imine (PubChem CID 145087914) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(1E,3E)-2,3-dimethylhexa-1,3-dienyl]propan-1-imine.
| Compound Name | N-[(1E,3E)-2,3-dimethylhexa-1,3-dienyl]propan-1-imine |
|---|---|
| PubChem CID | 145087914 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(1E,3E)-2,3-dimethylhexa-1,3-dienyl]propan-1-imine |
| SMILES | CC/C=N/C=C(C)/C(C)=C/CC |
| InChI | InChI=1S/C11H19N/c1-5-7-10(3)11(4)9-12-8-6-2/h7-9H,5-6H2,1-4H3/b10-7+,11-9+,12-8+ |
| InChIKey | KNGBMUVQGZHVJU-YMHJLSKCSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|