C8H8Cl2 — CID 91115524
2,6-dichloro-5-methylidenehepta-1,3,6-triene (PubChem CID 91115524) has the molecular formula C8H8Cl2 and a molecular weight of 175.06 g/mol. Its IUPAC name is 2,6-dichloro-5-methylidenehepta-1,3,6-triene.
| Compound Name | 2,6-dichloro-5-methylidenehepta-1,3,6-triene |
|---|---|
| PubChem CID | 91115524 |
| Molecular Formula | C8H8Cl2 |
| Molecular Weight | 175.06 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 2,6-dichloro-5-methylidenehepta-1,3,6-triene |
| SMILES | C=C(Cl)C=CC(=C)C(=C)Cl |
| InChI | InChI=1S/C8H8Cl2/c1-6(8(3)10)4-5-7(2)9/h4-5H,1-3H2 |
| InChIKey | UDBOVYUUGPCLHQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.06 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|