C6H8Cl2 — CID 102247590
(3E)-2,5-dichlorohexa-1,3-diene (PubChem CID 102247590) has the molecular formula C6H8Cl2 and a molecular weight of 151.04 g/mol. Its IUPAC name is (3E)-2,5-dichlorohexa-1,3-diene.
| Compound Name | (3E)-2,5-dichlorohexa-1,3-diene |
|---|---|
| PubChem CID | 102247590 |
| Molecular Formula | C6H8Cl2 |
| Molecular Weight | 151.04 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | (3E)-2,5-dichlorohexa-1,3-diene |
| SMILES | C=C(Cl)/C=C/C(C)Cl |
| InChI | InChI=1S/C6H8Cl2/c1-5(7)3-4-6(2)8/h3-4,6H,1H2,2H3/b4-3+ |
| InChIKey | NUFRVSZXROFAKT-ONEGZZNKSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.04 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|