C8H10ClNO — CID 143860101
[(2E,4Z)-6-chlorohepta-2,4-dien-3-yl] cyanate (PubChem CID 143860101) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is [(2E,4Z)-6-chlorohepta-2,4-dien-3-yl] cyanate.
| Compound Name | [(2E,4Z)-6-chlorohepta-2,4-dien-3-yl] cyanate |
|---|---|
| PubChem CID | 143860101 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | [(2E,4Z)-6-chlorohepta-2,4-dien-3-yl] cyanate |
| SMILES | C/C=C(\C=C/C(C)Cl)OC#N |
| InChI | InChI=1S/C8H10ClNO/c1-3-8(11-6-10)5-4-7(2)9/h3-5,7H,1-2H3/b5-4-,8-3+ |
| InChIKey | COQYKSDYTMKJMZ-UEQFWHKLSA-N |
| XLogP | 2.57 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|