C8H8ClNO — CID 145116854
[(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl] cyanate (PubChem CID 145116854) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is [(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl] cyanate.
| Compound Name | [(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl] cyanate |
|---|---|
| PubChem CID | 145116854 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | [(3E,5E)-5-chlorohepta-1,3,5-trien-3-yl] cyanate |
| SMILES | C=C/C(=C\C(Cl)=C/C)OC#N |
| InChI | InChI=1S/C8H8ClNO/c1-3-7(9)5-8(4-2)11-6-10/h3-5H,2H2,1H3/b7-3+,8-5+ |
| InChIKey | UIERMDDUZNXARG-IUMFQGNOSA-N |
| XLogP | 2.70 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|