C9H13ClO — CID 169205987
(3Z,5E)-5-chloro-3-ethenylhepta-3,5-dien-1-ol (PubChem CID 169205987) has the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. Its IUPAC name is (3Z,5E)-5-chloro-3-ethenylhepta-3,5-dien-1-ol.
| Compound Name | (3Z,5E)-5-chloro-3-ethenylhepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 169205987 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3Z,5E)-5-chloro-3-ethenylhepta-3,5-dien-1-ol |
| SMILES | C=C/C(=C\C(Cl)=C/C)CCO |
| InChI | InChI=1S/C9H13ClO/c1-3-8(5-6-11)7-9(10)4-2/h3-4,7,11H,1,5-6H2,2H3/b8-7+,9-4+ |
| InChIKey | CBVZVVQSOREDMC-UQZXCRFKSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|