C9H12ClN — CID 144617687
(3Z,5E)-5-chloro-3-ethenylhepta-1,3,5-trien-2-amine (PubChem CID 144617687) has the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. Its IUPAC name is (3Z,5E)-5-chloro-3-ethenylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-chloro-3-ethenylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144617687 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (3Z,5E)-5-chloro-3-ethenylhepta-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C/C(Cl)=C\C)C(=C)N |
| InChI | InChI=1S/C9H12ClN/c1-4-8(7(3)11)6-9(10)5-2/h4-6H,1,3,11H2,2H3/b8-6-,9-5+ |
| InChIKey | ANRHRZKGRFSAII-POEMVANMSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|