C12H12Cl2 — CID 145158883
(3E,7E)-3,8-dichloro-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 145158883) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is (3E,7E)-3,8-dichloro-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3E,7E)-3,8-dichloro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 145158883 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | (3E,7E)-3,8-dichloro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C/C(Cl)=C\C(=C)C(=C)/C=C(/Cl)C=C |
| InChI | InChI=1S/C12H12Cl2/c1-5-11(13)7-9(3)10(4)8-12(14)6-2/h5-8H,1-4H2/b11-7+,12-8+ |
| InChIKey | RNXPNLVFJMPFBJ-MKICQXMISA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|