C6H6ClI — CID 167082168
(3E)-4-chloro-2-iodohexa-1,3,5-triene (PubChem CID 167082168) has the molecular formula C6H6ClI and a molecular weight of 240.47 g/mol. Its IUPAC name is (3E)-4-chloro-2-iodohexa-1,3,5-triene.
| Compound Name | (3E)-4-chloro-2-iodohexa-1,3,5-triene |
|---|---|
| PubChem CID | 167082168 |
| Molecular Formula | C6H6ClI |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 239.92 |
| IUPAC Name | (3E)-4-chloro-2-iodohexa-1,3,5-triene |
| SMILES | C=C/C(Cl)=C\C(=C)I |
| InChI | InChI=1S/C6H6ClI/c1-3-6(7)4-5(2)8/h3-4H,1-2H2/b6-4+ |
| InChIKey | GHWKWJYHEMPYPA-GQCTYLIASA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|