C11H13Cl — CID 154695464
(3E)-3-chloro-8-methyl-5-methylidenenona-1,3-dien-6-yne (PubChem CID 154695464) has the molecular formula C11H13Cl and a molecular weight of 180.68 g/mol. Its IUPAC name is (3E)-3-chloro-8-methyl-5-methylidenenona-1,3-dien-6-yne.
| Compound Name | (3E)-3-chloro-8-methyl-5-methylidenenona-1,3-dien-6-yne |
|---|---|
| PubChem CID | 154695464 |
| Molecular Formula | C11H13Cl |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (3E)-3-chloro-8-methyl-5-methylidenenona-1,3-dien-6-yne |
| SMILES | C=C/C(Cl)=C\C(=C)C#CC(C)C |
| InChI | InChI=1S/C11H13Cl/c1-5-11(12)8-10(4)7-6-9(2)3/h5,8-9H,1,4H2,2-3H3/b11-8+ |
| InChIKey | BPDRJDKIGSGYOY-DHZHZOJOSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|