C11H15ClO — CID 156886752
(5Z,6Z)-8-chloro-5-ethylidenenona-6,8-dien-2-one (PubChem CID 156886752) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is (5Z,6Z)-8-chloro-5-ethylidenenona-6,8-dien-2-one.
| Compound Name | (5Z,6Z)-8-chloro-5-ethylidenenona-6,8-dien-2-one |
|---|---|
| PubChem CID | 156886752 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (5Z,6Z)-8-chloro-5-ethylidenenona-6,8-dien-2-one |
| SMILES | C=C(Cl)/C=C\C(=C/C)CCC(C)=O |
| InChI | InChI=1S/C11H15ClO/c1-4-11(7-5-9(2)12)8-6-10(3)13/h4-5,7H,2,6,8H2,1,3H3/b7-5-,11-4+ |
| InChIKey | DRSHSGBDPWXASP-WZXAJVQYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|