C12H17ClO — CID 156886732
(5Z,6Z)-8-chloro-5-ethylidene-7-methylnona-6,8-dien-2-one (PubChem CID 156886732) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is (5Z,6Z)-8-chloro-5-ethylidene-7-methylnona-6,8-dien-2-one.
| Compound Name | (5Z,6Z)-8-chloro-5-ethylidene-7-methylnona-6,8-dien-2-one |
|---|---|
| PubChem CID | 156886732 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (5Z,6Z)-8-chloro-5-ethylidene-7-methylnona-6,8-dien-2-one |
| SMILES | C=C(Cl)/C(C)=C\C(=C/C)CCC(C)=O |
| InChI | InChI=1S/C12H17ClO/c1-5-12(7-6-10(3)14)8-9(2)11(4)13/h5,8H,4,6-7H2,1-3H3/b9-8-,12-5- |
| InChIKey | KSGQJBRNLCTWMA-UUBDPURSSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|