C11H19NO — CID 123233077
4-ethylidene-N,6-dimethylhept-5-enamide (PubChem CID 123233077) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-ethylidene-N,6-dimethylhept-5-enamide.
| Compound Name | 4-ethylidene-N,6-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 123233077 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-ethylidene-N,6-dimethylhept-5-enamide |
| SMILES | CC=C(C=C(C)C)CCC(=O)NC |
| InChI | InChI=1S/C11H19NO/c1-5-10(8-9(2)3)6-7-11(13)12-4/h5,8H,6-7H2,1-4H3,(H,12,13) |
| InChIKey | YTOSWMCMNUKIOI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|